C10H19NO3 — CID 71248203
2-[[(2S,6S)-2-methoxy-3-methyl-3,6-dihydro-2H-pyran-6-yl]methylamino]ethanol (PubChem CID 71248203) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[[(2S,6S)-2-methoxy-3-methyl-3,6-dihydro-2H-pyran-6-yl]methylamino]ethanol.
| Compound Name | 2-[[(2S,6S)-2-methoxy-3-methyl-3,6-dihydro-2H-pyran-6-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 71248203 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-[[(2S,6S)-2-methoxy-3-methyl-3,6-dihydro-2H-pyran-6-yl]methylamino]ethanol |
| SMILES | CO[C@H]1O[C@H](CNCCO)C=CC1C |
| InChI | InChI=1S/C10H19NO3/c1-8-3-4-9(7-11-5-6-12)14-10(8)13-2/h3-4,8-12H,5-7H2,1-2H3/t8?,9-,10-/m0/s1 |
| InChIKey | PDWKGPKYFGODAY-AGROOBSYSA-N |
| XLogP | 0.13 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|