C8H16N2O3 — CID 91417768
3-amino-6-[(2-hydroxyethylamino)methyl]-3,6-dihydro-2H-pyran-2-ol (PubChem CID 91417768) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-amino-6-[(2-hydroxyethylamino)methyl]-3,6-dihydro-2H-pyran-2-ol.
| Compound Name | 3-amino-6-[(2-hydroxyethylamino)methyl]-3,6-dihydro-2H-pyran-2-ol |
|---|---|
| PubChem CID | 91417768 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-amino-6-[(2-hydroxyethylamino)methyl]-3,6-dihydro-2H-pyran-2-ol |
| SMILES | NC1C=CC(CNCCO)OC1O |
| InChI | InChI=1S/C8H16N2O3/c9-7-2-1-6(13-8(7)12)5-10-3-4-11/h1-2,6-8,10-12H,3-5,9H2 |
| InChIKey | JNVCWMZUBXNCDQ-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|