C8H16N2O2 — CID 91058078
2-[(3-amino-3,6-dihydro-2H-pyran-6-yl)methylamino]ethanol (PubChem CID 91058078) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-[(3-amino-3,6-dihydro-2H-pyran-6-yl)methylamino]ethanol.
| Compound Name | 2-[(3-amino-3,6-dihydro-2H-pyran-6-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 91058078 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-[(3-amino-3,6-dihydro-2H-pyran-6-yl)methylamino]ethanol |
| SMILES | NC1C=CC(CNCCO)OC1 |
| InChI | InChI=1S/C8H16N2O2/c9-7-1-2-8(12-6-7)5-10-3-4-11/h1-2,7-8,10-11H,3-6,9H2 |
| InChIKey | GFVXETXGEKQGHE-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|