C9H17NO3 — CID 143974263
3-(3,6-dihydro-2H-pyran-6-ylmethylamino)propane-1,2-diol (PubChem CID 143974263) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyran-6-ylmethylamino)propane-1,2-diol.
| Compound Name | 3-(3,6-dihydro-2H-pyran-6-ylmethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 143974263 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyran-6-ylmethylamino)propane-1,2-diol |
| SMILES | OCC(O)CNCC1C=CCCO1 |
| InChI | InChI=1S/C9H17NO3/c11-7-8(12)5-10-6-9-3-1-2-4-13-9/h1,3,8-12H,2,4-7H2 |
| InChIKey | PMMQKNPAZRCSBK-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|