C9H18N2O2 — CID 143974301
1-amino-3-(3,6-dihydro-2H-pyran-6-ylmethylamino)propan-2-ol (PubChem CID 143974301) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-amino-3-(3,6-dihydro-2H-pyran-6-ylmethylamino)propan-2-ol.
| Compound Name | 1-amino-3-(3,6-dihydro-2H-pyran-6-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 143974301 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-amino-3-(3,6-dihydro-2H-pyran-6-ylmethylamino)propan-2-ol |
| SMILES | NCC(O)CNCC1C=CCCO1 |
| InChI | InChI=1S/C9H18N2O2/c10-5-8(12)6-11-7-9-3-1-2-4-13-9/h1,3,8-9,11-12H,2,4-7,10H2 |
| InChIKey | YKTYQZZFUKRVLM-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|