C21H27N5S+2 — CID 7125026
3-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 7125026) has the molecular formula C21H27N5S+2 and a molecular weight of 381.55 g/mol. Its IUPAC name is 3-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 7125026 |
| Molecular Formula | C21H27N5S+2 |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 3-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(CC[NH+]2CC[NH+](Cc3ccccc3)CC2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H25N5S/c27-21-23-22-20(26(21)19-9-5-2-6-10-19)11-12-24-13-15-25(16-14-24)17-18-7-3-1-4-8-18/h1-10H,11-17H2,(H,23,27)/p+2 |
| InChIKey | GLEFOAXXAIODRL-UHFFFAOYSA-P |
| XLogP | 0.46 |
| TPSA | 42.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|