C22H18N4S2 — CID 11741851
3-(2-phenothiazin-10-ylethyl)-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 11741851) has the molecular formula C22H18N4S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 3-(2-phenothiazin-10-ylethyl)-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-phenothiazin-10-ylethyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 11741851 |
| Molecular Formula | C22H18N4S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 3-(2-phenothiazin-10-ylethyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(CCN2c3ccccc3Sc3ccccc32)n1-c1ccccc1 |
| InChI | InChI=1S/C22H18N4S2/c27-22-24-23-21(26(22)16-8-2-1-3-9-16)14-15-25-17-10-4-6-12-19(17)28-20-13-7-5-11-18(20)25/h1-13H,14-15H2,(H,24,27) |
| InChIKey | HMXUEVLUFNJEII-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|