C22H27N3O4S — CID 71252023
[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-[4-[4-(hydroxymethyl)-2-methylphenyl]piperazin-1-yl]methanone (PubChem CID 71252023) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is [4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-[4-[4-(hydroxymethyl)-2-methylphenyl]piperazin-1-yl]methanone.
| Compound Name | [4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-[4-[4-(hydroxymethyl)-2-methylphenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 71252023 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-[4-[4-(hydroxymethyl)-2-methylphenyl]piperazin-1-yl]methanone |
| SMILES | Cc1cc(CO)ccc1N1CCN(C(=O)c2ccc(N3CCCS3(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C22H27N3O4S/c1-17-15-18(16-26)3-8-21(17)23-10-12-24(13-11-23)22(27)19-4-6-20(7-5-19)25-9-2-14-30(25,28)29/h3-8,15,26H,2,9-14,16H2,1H3 |
| InChIKey | RWBAVMNVQIGDII-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|