C12H17NO3S — CID 62121729
[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylphenyl]methanol (PubChem CID 62121729) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is [4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylphenyl]methanol.
| Compound Name | [4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylphenyl]methanol |
|---|---|
| PubChem CID | 62121729 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | [4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylphenyl]methanol |
| SMILES | Cc1cc(CO)ccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H17NO3S/c1-10-8-11(9-14)2-3-12(10)13-4-6-17(15,16)7-5-13/h2-3,8,14H,4-7,9H2,1H3 |
| InChIKey | OTPAQCRKWDPEAG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|