About [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol
[3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol (PubChem CID 79174316) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol |
| PubChem CID | 79174316 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol |
| SMILES | Cc1cc(CO)ccc1N1CCC2CCC(C1)N2C |
| InChI | InChI=1S/C16H24N2O/c1-12-9-13(11-19)3-6-16(12)18-8-7-14-4-5-15(10-18)17(14)2/h3,6,9,14-15,19H,4-5,7-8,10-11H2,1-2H3 |
| InChIKey | LCSHIBKKCWLJPV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol?
The IUPAC name of [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol (CID 79174316) is [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol.
What is the SMILES notation for [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol?
The canonical SMILES for [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol is Cc1cc(CO)ccc1N1CCC2CCC(C1)N2C.
What is the InChIKey of [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol?
The InChIKey is LCSHIBKKCWLJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-12-9-13(11-19)3-6-16(12)18-8-7-14-4-5-15(10-18)17(14)2/h3,6,9,14-15,19H,4-5,7-8,10-11H2,1-2H3.
What are the key properties of [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol?
[3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol has a molecular weight of 260.38 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol is sourced from PubChem (CID 79174316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).