C17H12N4 — CID 71255097
2-(2-pyridin-2-ylethenyl)-7H-pyrazolo[5,4-h]quinoline (PubChem CID 71255097) has the molecular formula C17H12N4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-(2-pyridin-2-ylethenyl)-7H-pyrazolo[5,4-h]quinoline.
| Compound Name | 2-(2-pyridin-2-ylethenyl)-7H-pyrazolo[5,4-h]quinoline |
|---|---|
| PubChem CID | 71255097 |
| Molecular Formula | C17H12N4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-(2-pyridin-2-ylethenyl)-7H-pyrazolo[5,4-h]quinoline |
| SMILES | C(=Cc1ccc2ccc3[nH]ncc3c2n1)c1ccccn1 |
| InChI | InChI=1S/C17H12N4/c1-2-10-18-13(3-1)7-8-14-6-4-12-5-9-16-15(11-19-21-16)17(12)20-14/h1-11H,(H,19,21) |
| InChIKey | BZXOEEITXREACD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |