C23H28N4O2S — CID 71255407
N'-[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]butane-1,4-diamine (PubChem CID 71255407) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is N'-[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]butane-1,4-diamine.
| Compound Name | N'-[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 71255407 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N'-[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]butane-1,4-diamine |
| SMILES | Cc1ccc2nc(N3CCS(=O)(=O)c4ccccc4C3)cc(NCCCCN)c2c1 |
| InChI | InChI=1S/C23H28N4O2S/c1-17-8-9-20-19(14-17)21(25-11-5-4-10-24)15-23(26-20)27-12-13-30(28,29)22-7-3-2-6-18(22)16-27/h2-3,6-9,14-15H,4-5,10-13,16,24H2,1H3,(H,25,26) |
| InChIKey | WPTPJPJQMRFIMJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|