C26H28N2O3 — CID 71257969
4-[3-(dibenzylamino)phenyl]-4-hydroxypiperidine-1-carboxylic acid (PubChem CID 71257969) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-[3-(dibenzylamino)phenyl]-4-hydroxypiperidine-1-carboxylic acid.
| Compound Name | 4-[3-(dibenzylamino)phenyl]-4-hydroxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 71257969 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-[3-(dibenzylamino)phenyl]-4-hydroxypiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(O)(c2cccc(N(Cc3ccccc3)Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C26H28N2O3/c29-25(30)27-16-14-26(31,15-17-27)23-12-7-13-24(18-23)28(19-21-8-3-1-4-9-21)20-22-10-5-2-6-11-22/h1-13,18,31H,14-17,19-20H2,(H,29,30) |
| InChIKey | FYUXTOKIXCCJCI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |