C19H19F2N5O3S — CID 71261535
5-amino-2-(2,6-difluorophenyl)-N-[4-(4-hydroxypentoxy)pyrimidin-5-yl]-1,3-thiazole-4-carboxamide (PubChem CID 71261535) has the molecular formula C19H19F2N5O3S and a molecular weight of 435.46 g/mol. Its IUPAC name is 5-amino-2-(2,6-difluorophenyl)-N-[4-(4-hydroxypentoxy)pyrimidin-5-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 5-amino-2-(2,6-difluorophenyl)-N-[4-(4-hydroxypentoxy)pyrimidin-5-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71261535 |
| Molecular Formula | C19H19F2N5O3S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 5-amino-2-(2,6-difluorophenyl)-N-[4-(4-hydroxypentoxy)pyrimidin-5-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(O)CCCOc1ncncc1NC(=O)c1nc(-c2c(F)cccc2F)sc1N |
| InChI | InChI=1S/C19H19F2N5O3S/c1-10(27)4-3-7-29-18-13(8-23-9-24-18)25-17(28)15-16(22)30-19(26-15)14-11(20)5-2-6-12(14)21/h2,5-6,8-10,27H,3-4,7,22H2,1H3,(H,25,28) |
| InChIKey | KUIZTHGRVNKVDJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|