C18H17F2N3O3S2 — CID 71261802
2-(2,6-difluorophenyl)-N-[5-(4-hydroxypentoxy)-1,2-thiazol-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 71261802) has the molecular formula C18H17F2N3O3S2 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-[5-(4-hydroxypentoxy)-1,2-thiazol-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2,6-difluorophenyl)-N-[5-(4-hydroxypentoxy)-1,2-thiazol-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71261802 |
| Molecular Formula | C18H17F2N3O3S2 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-[5-(4-hydroxypentoxy)-1,2-thiazol-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(O)CCCOc1sncc1NC(=O)c1csc(-c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C18H17F2N3O3S2/c1-10(24)4-3-7-26-18-13(8-21-28-18)22-16(25)14-9-27-17(23-14)15-11(19)5-2-6-12(15)20/h2,5-6,8-10,24H,3-4,7H2,1H3,(H,22,25) |
| InChIKey | VJRPSGBUFGNPFZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|