C59H60N2 — CID 71263458
7-N,12-N-bis(4-butylphenyl)-7-N-(4-tert-butylphenyl)-12-N-(4-propan-2-ylphenyl)benzo[k]fluoranthene-7,12-diamine (PubChem CID 71263458) has the molecular formula C59H60N2 and a molecular weight of 797.14 g/mol. Its IUPAC name is 7-N,12-N-bis(4-butylphenyl)-7-N-(4-tert-butylphenyl)-12-N-(4-propan-2-ylphenyl)benzo[k]fluoranthene-7,12-diamine.
| Compound Name | 7-N,12-N-bis(4-butylphenyl)-7-N-(4-tert-butylphenyl)-12-N-(4-propan-2-ylphenyl)benzo[k]fluoranthene-7,12-diamine |
|---|---|
| PubChem CID | 71263458 |
| Molecular Formula | C59H60N2 |
| Molecular Weight | 797.14 g/mol |
| Exact Mass | 796.48 |
| IUPAC Name | 7-N,12-N-bis(4-butylphenyl)-7-N-(4-tert-butylphenyl)-12-N-(4-propan-2-ylphenyl)benzo[k]fluoranthene-7,12-diamine |
| SMILES | CCCCc1ccc(N(c2ccc(C(C)C)cc2)c2c3c(c(N(c4ccc(CCCC)cc4)c4ccc(C(C)(C)C)cc4)c4ccccc24)-c2cccc4cccc-3c24)cc1 |
| InChI | InChI=1S/C59H60N2/c1-8-10-16-41-24-32-46(33-25-41)60(48-36-28-43(29-37-48)40(3)4)57-50-20-12-13-21-51(50)58(56-53-23-15-19-44-18-14-22-52(54(44)53)55(56)57)61(47-34-26-42(27-35-47)17-11-9-2)49-38-30-45(31-39-49)59(5,6)7/h12-15,18-40H,8-11,16-17H2,1-7H3 |
| InChIKey | MXGTZORUOBLXOJ-UHFFFAOYSA-N |
| XLogP | 17.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.14 |
| LogP ≤ 5 | 17.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|