C20H24N6 — CID 71263983
(4Z)-4-[(1-benzylpiperidin-3-yl)-(methylideneamino)methylidene]-7H-pyrrolo[2,3-d]pyrimidin-3-amine (PubChem CID 71263983) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is (4Z)-4-[(1-benzylpiperidin-3-yl)-(methylideneamino)methylidene]-7H-pyrrolo[2,3-d]pyrimidin-3-amine.
| Compound Name | (4Z)-4-[(1-benzylpiperidin-3-yl)-(methylideneamino)methylidene]-7H-pyrrolo[2,3-d]pyrimidin-3-amine |
|---|---|
| PubChem CID | 71263983 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (4Z)-4-[(1-benzylpiperidin-3-yl)-(methylideneamino)methylidene]-7H-pyrrolo[2,3-d]pyrimidin-3-amine |
| SMILES | C=N/C(=C1/c2cc[nH]c2N=CN1N)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H24N6/c1-22-18(19-17-9-10-23-20(17)24-14-26(19)21)16-8-5-11-25(13-16)12-15-6-3-2-4-7-15/h2-4,6-7,9-10,14,16,23H,1,5,8,11-13,21H2/b19-18- |
| InChIKey | ITPCDQICHUEUIW-HNENSFHCSA-N |
| XLogP | 3.15 |
| TPSA | 73.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|