C25H33NNaO5S — CID 71268580
CID 71268580 (PubChem CID 71268580) has the molecular formula C25H33NNaO5S and a molecular weight of 482.60 g/mol.
| Compound Name | CID 71268580 |
|---|---|
| PubChem CID | 71268580 |
| Molecular Formula | C25H33NNaO5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | — |
| SMILES | COc1ccc(CC(=O)O)cc1Oc1ccc(NC(=O)C(C)(C)C)cc1CSC(C)(C)C.[Na] |
| InChI | InChI=1S/C25H33NO5S.Na/c1-24(2,3)23(29)26-18-9-11-19(17(14-18)15-32-25(4,5)6)31-21-12-16(13-22(27)28)8-10-20(21)30-7;/h8-12,14H,13,15H2,1-7H3,(H,26,29)(H,27,28); |
| InChIKey | XITXYPWUKORJNQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |