C21H27NO4S — CID 86677222
methyl 2-[3-[4-amino-2-(tert-butylsulfanylmethyl)phenoxy]-4-methoxyphenyl]acetate (PubChem CID 86677222) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is methyl 2-[3-[4-amino-2-(tert-butylsulfanylmethyl)phenoxy]-4-methoxyphenyl]acetate.
| Compound Name | methyl 2-[3-[4-amino-2-(tert-butylsulfanylmethyl)phenoxy]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 86677222 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | methyl 2-[3-[4-amino-2-(tert-butylsulfanylmethyl)phenoxy]-4-methoxyphenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OC)c(Oc2ccc(N)cc2CSC(C)(C)C)c1 |
| InChI | InChI=1S/C21H27NO4S/c1-21(2,3)27-13-15-12-16(22)7-9-17(15)26-19-10-14(11-20(23)25-5)6-8-18(19)24-4/h6-10,12H,11,13,22H2,1-5H3 |
| InChIKey | CHZPADDMRALYFI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|