C20H22F3NO4S — CID 58372871
ethyl 2-[3-[4-amino-2-(2,2,2-trifluoroethylsulfanylmethyl)phenoxy]-4-methoxyphenyl]acetate (PubChem CID 58372871) has the molecular formula C20H22F3NO4S and a molecular weight of 429.46 g/mol. Its IUPAC name is ethyl 2-[3-[4-amino-2-(2,2,2-trifluoroethylsulfanylmethyl)phenoxy]-4-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[3-[4-amino-2-(2,2,2-trifluoroethylsulfanylmethyl)phenoxy]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 58372871 |
| Molecular Formula | C20H22F3NO4S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | ethyl 2-[3-[4-amino-2-(2,2,2-trifluoroethylsulfanylmethyl)phenoxy]-4-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)c(Oc2ccc(N)cc2CSCC(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F3NO4S/c1-3-27-19(25)9-13-4-6-17(26-2)18(8-13)28-16-7-5-15(24)10-14(16)11-29-12-20(21,22)23/h4-8,10H,3,9,11-12,24H2,1-2H3 |
| InChIKey | DSANFMUSEDWBPR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|