C24H24ClNO4S — CID 87094902
ethyl 2-[3-[4-amino-2-[(4-chlorophenyl)-sulfanylmethyl]phenoxy]-4-methoxyphenyl]acetate (PubChem CID 87094902) has the molecular formula C24H24ClNO4S and a molecular weight of 457.98 g/mol. Its IUPAC name is ethyl 2-[3-[4-amino-2-[(4-chlorophenyl)-sulfanylmethyl]phenoxy]-4-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[3-[4-amino-2-[(4-chlorophenyl)-sulfanylmethyl]phenoxy]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 87094902 |
| Molecular Formula | C24H24ClNO4S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | ethyl 2-[3-[4-amino-2-[(4-chlorophenyl)-sulfanylmethyl]phenoxy]-4-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)c(Oc2ccc(N)cc2C(S)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H24ClNO4S/c1-3-29-23(27)13-15-4-10-21(28-2)22(12-15)30-20-11-9-18(26)14-19(20)24(31)16-5-7-17(25)8-6-16/h4-12,14,24,31H,3,13,26H2,1-2H3 |
| InChIKey | WHMZAGWIPOFBLH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|