C22H26O7 — CID 67633588
[4-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl] 2-(4-hydroxy-3-methoxyphenyl)butanoate (PubChem CID 67633588) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is [4-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl] 2-(4-hydroxy-3-methoxyphenyl)butanoate.
| Compound Name | [4-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl] 2-(4-hydroxy-3-methoxyphenyl)butanoate |
|---|---|
| PubChem CID | 67633588 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [4-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl] 2-(4-hydroxy-3-methoxyphenyl)butanoate |
| SMILES | CCOC(=O)Cc1ccc(OC(=O)C(CC)c2ccc(O)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C22H26O7/c1-5-16(15-8-9-17(23)19(13-15)26-3)22(25)29-18-10-7-14(11-20(18)27-4)12-21(24)28-6-2/h7-11,13,16,23H,5-6,12H2,1-4H3 |
| InChIKey | JKHVWRFHVMSYQJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|