C24H26O9 — CID 59499467
5-[4-[5-(4-hydroxy-3-methoxyphenyl)-2,4-dioxopentyl]-2-methoxyphenoxy]-5-oxopentanoic acid (PubChem CID 59499467) has the molecular formula C24H26O9 and a molecular weight of 458.46 g/mol. Its IUPAC name is 5-[4-[5-(4-hydroxy-3-methoxyphenyl)-2,4-dioxopentyl]-2-methoxyphenoxy]-5-oxopentanoic acid.
| Compound Name | 5-[4-[5-(4-hydroxy-3-methoxyphenyl)-2,4-dioxopentyl]-2-methoxyphenoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 59499467 |
| Molecular Formula | C24H26O9 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 5-[4-[5-(4-hydroxy-3-methoxyphenyl)-2,4-dioxopentyl]-2-methoxyphenoxy]-5-oxopentanoic acid |
| SMILES | COc1cc(CC(=O)CC(=O)Cc2ccc(OC(=O)CCCC(=O)O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C24H26O9/c1-31-21-12-15(6-8-19(21)27)10-17(25)14-18(26)11-16-7-9-20(22(13-16)32-2)33-24(30)5-3-4-23(28)29/h6-9,12-13,27H,3-5,10-11,14H2,1-2H3,(H,28,29) |
| InChIKey | DRMPMYKXELSXDW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|