C18H27NO5 — CID 57034578
6-[[2-(3,4-dimethoxyphenyl)acetyl]amino]octanoic acid (PubChem CID 57034578) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 6-[[2-(3,4-dimethoxyphenyl)acetyl]amino]octanoic acid.
| Compound Name | 6-[[2-(3,4-dimethoxyphenyl)acetyl]amino]octanoic acid |
|---|---|
| PubChem CID | 57034578 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 6-[[2-(3,4-dimethoxyphenyl)acetyl]amino]octanoic acid |
| SMILES | CCC(CCCCC(=O)O)NC(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H27NO5/c1-4-14(7-5-6-8-18(21)22)19-17(20)12-13-9-10-15(23-2)16(11-13)24-3/h9-11,14H,4-8,12H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | FPHJORHYMSJBGX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|