C27H34FN5O4SSi — CID 71269861
[4-[5-fluoro-2-[[2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-1,3-thiazole-4-carbonyl]amino]phenyl]cyclohex-3-en-1-yl]-methylcarbamic acid (PubChem CID 71269861) has the molecular formula C27H34FN5O4SSi and a molecular weight of 571.75 g/mol. Its IUPAC name is [4-[5-fluoro-2-[[2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-1,3-thiazole-4-carbonyl]amino]phenyl]cyclohex-3-en-1-yl]-methylcarbamic acid.
| Compound Name | [4-[5-fluoro-2-[[2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-1,3-thiazole-4-carbonyl]amino]phenyl]cyclohex-3-en-1-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 71269861 |
| Molecular Formula | C27H34FN5O4SSi |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | [4-[5-fluoro-2-[[2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-1,3-thiazole-4-carbonyl]amino]phenyl]cyclohex-3-en-1-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1CC=C(c2cc(F)ccc2NC(=O)c2csc(-c3cnn(COCC[Si](C)(C)C)c3)n2)CC1 |
| InChI | InChI=1S/C27H34FN5O4SSi/c1-32(27(35)36)21-8-5-18(6-9-21)22-13-20(28)7-10-23(22)30-25(34)24-16-38-26(31-24)19-14-29-33(15-19)17-37-11-12-39(2,3)4/h5,7,10,13-16,21H,6,8-9,11-12,17H2,1-4H3,(H,30,34)(H,35,36) |
| InChIKey | DQXXZKWOUUSPOQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|