C9H14N2O4S — CID 7127106
[(3S,4R)-4-(acetylcarbamoylamino)thiolan-3-yl] acetate (PubChem CID 7127106) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is [(3S,4R)-4-(acetylcarbamoylamino)thiolan-3-yl] acetate.
| Compound Name | [(3S,4R)-4-(acetylcarbamoylamino)thiolan-3-yl] acetate |
|---|---|
| PubChem CID | 7127106 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | [(3S,4R)-4-(acetylcarbamoylamino)thiolan-3-yl] acetate |
| SMILES | CC(=O)NC(=O)N[C@H]1CSC[C@H]1OC(C)=O |
| InChI | InChI=1S/C9H14N2O4S/c1-5(12)10-9(14)11-7-3-16-4-8(7)15-6(2)13/h7-8H,3-4H2,1-2H3,(H2,10,11,12,14)/t7-,8+/m0/s1 |
| InChIKey | OWXRNMADXPMIAB-JGVFFNPUSA-N |
| XLogP | -0.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |