C22H21N3O5 — CID 71273065
methyl 2-[[4-[2-(4-carbamoylphenyl)ethynyl]benzoyl]-methylamino]-3-(methylamino)-3-oxopropanoate (PubChem CID 71273065) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is methyl 2-[[4-[2-(4-carbamoylphenyl)ethynyl]benzoyl]-methylamino]-3-(methylamino)-3-oxopropanoate.
| Compound Name | methyl 2-[[4-[2-(4-carbamoylphenyl)ethynyl]benzoyl]-methylamino]-3-(methylamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 71273065 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | methyl 2-[[4-[2-(4-carbamoylphenyl)ethynyl]benzoyl]-methylamino]-3-(methylamino)-3-oxopropanoate |
| SMILES | CNC(=O)C(C(=O)OC)N(C)C(=O)c1ccc(C#Cc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O5/c1-24-20(27)18(22(29)30-3)25(2)21(28)17-12-8-15(9-13-17)5-4-14-6-10-16(11-7-14)19(23)26/h6-13,18H,1-3H3,(H2,23,26)(H,24,27) |
| InChIKey | FYGBZHAMPSMTSJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|