C14H17IN2O4 — CID 170986207
methyl 2-[(4-iodo-3-methylbenzoyl)-methylamino]-3-(methylamino)-3-oxopropanoate (PubChem CID 170986207) has the molecular formula C14H17IN2O4 and a molecular weight of 404.20 g/mol. Its IUPAC name is methyl 2-[(4-iodo-3-methylbenzoyl)-methylamino]-3-(methylamino)-3-oxopropanoate.
| Compound Name | methyl 2-[(4-iodo-3-methylbenzoyl)-methylamino]-3-(methylamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 170986207 |
| Molecular Formula | C14H17IN2O4 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | methyl 2-[(4-iodo-3-methylbenzoyl)-methylamino]-3-(methylamino)-3-oxopropanoate |
| SMILES | CNC(=O)C(C(=O)OC)N(C)C(=O)c1ccc(I)c(C)c1 |
| InChI | InChI=1S/C14H17IN2O4/c1-8-7-9(5-6-10(8)15)13(19)17(3)11(12(18)16-2)14(20)21-4/h5-7,11H,1-4H3,(H,16,18) |
| InChIKey | XKUUGTQXJIIGOK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|