C16H28O2 — CID 71274532
2,3-dimethylbutan-2-yl 2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 71274532) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl 2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | 2,3-dimethylbutan-2-yl 2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71274532 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2,3-dimethylbutan-2-yl 2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | CC(C)=CC1(C(=O)OC(C)(C)C(C)C)CC1(C)C |
| InChI | InChI=1S/C16H28O2/c1-11(2)9-16(10-14(16,5)6)13(17)18-15(7,8)12(3)4/h9,12H,10H2,1-8H3 |
| InChIKey | YGRCRYNQUPYJBB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|