C50H59N7O3Si — CID 71280346
N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-[6-methyl-1-(2-morpholin-4-ylethyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71280346) has the molecular formula C50H59N7O3Si and a molecular weight of 834.15 g/mol. Its IUPAC name is N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-[6-methyl-1-(2-morpholin-4-ylethyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-[6-methyl-1-(2-morpholin-4-ylethyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71280346 |
| Molecular Formula | C50H59N7O3Si |
| Molecular Weight | 834.15 g/mol |
| Exact Mass | 833.44 |
| IUPAC Name | N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-[6-methyl-1-(2-morpholin-4-ylethyl)indazol-3-yl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | Cc1ccc2c(-c3cnc4c(n3)c(C(=O)NC(C)(C)CO[Si](C)(C)C(C)(C)C)cn4C(c3ccccc3)(c3ccccc3)c3ccccc3)nn(CCN3CCOCC3)c2c1 |
| InChI | InChI=1S/C50H59N7O3Si/c1-36-24-25-40-43(32-36)57(27-26-55-28-30-59-31-29-55)54-44(40)42-33-51-46-45(52-42)41(47(58)53-49(5,6)35-60-61(7,8)48(2,3)4)34-56(46)50(37-18-12-9-13-19-37,38-20-14-10-15-21-38)39-22-16-11-17-23-39/h9-25,32-34H,26-31,35H2,1-8H3,(H,53,58) |
| InChIKey | PUXXAIBZAXLJNH-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.15 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|