C16H18N4O4 — CID 71284376
5-ethyl-4-hydroxy-2-oxo-6-(5-pyrrolidin-1-ylpyrazin-2-yl)-1H-pyridine-3-carboxylic acid (PubChem CID 71284376) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 5-ethyl-4-hydroxy-2-oxo-6-(5-pyrrolidin-1-ylpyrazin-2-yl)-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-ethyl-4-hydroxy-2-oxo-6-(5-pyrrolidin-1-ylpyrazin-2-yl)-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 71284376 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 5-ethyl-4-hydroxy-2-oxo-6-(5-pyrrolidin-1-ylpyrazin-2-yl)-1H-pyridine-3-carboxylic acid |
| SMILES | CCc1c(-c2cnc(N3CCCC3)cn2)[nH]c(=O)c(C(=O)O)c1O |
| InChI | InChI=1S/C16H18N4O4/c1-2-9-13(19-15(22)12(14(9)21)16(23)24)10-7-18-11(8-17-10)20-5-3-4-6-20/h7-8H,2-6H2,1H3,(H,23,24)(H2,19,21,22) |
| InChIKey | YXSSIGUDJIJQFF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |