C23H29N3O4 — CID 71284663
6-[4-[(3aR,4R,6aS)-4-(dimethylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 71284663) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 6-[4-[(3aR,4R,6aS)-4-(dimethylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-[4-[(3aR,4R,6aS)-4-(dimethylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 71284663 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 6-[4-[(3aR,4R,6aS)-4-(dimethylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | CCc1c(-c2ccc(N3C[C@H]4CC[C@@H](N(C)C)[C@H]4C3)cc2)[nH]c(=O)c(C(=O)O)c1O |
| InChI | InChI=1S/C23H29N3O4/c1-4-16-20(24-22(28)19(21(16)27)23(29)30)13-5-8-15(9-6-13)26-11-14-7-10-18(25(2)3)17(14)12-26/h5-6,8-9,14,17-18H,4,7,10-12H2,1-3H3,(H,29,30)(H2,24,27,28)/t14-,17+,18-/m1/s1 |
| InChIKey | UJLOBQHPDAJFIB-FHLIZLRMSA-N |
| XLogP | 2.78 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |