C23H29N3O3 — CID 144545504
6-[4-[(4R,6aS)-4-(dimethylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 144545504) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 6-[4-[(4R,6aS)-4-(dimethylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-[4-[(4R,6aS)-4-(dimethylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 144545504 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 6-[4-[(4R,6aS)-4-(dimethylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(=O)[nH]c1-c1ccc(N2CC3[C@H](CC[C@H]3N(C)C)C2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-4-14-11-18(23(28)29)22(27)24-21(14)15-5-8-17(9-6-15)26-12-16-7-10-20(25(2)3)19(16)13-26/h5-6,8-9,11,16,19-20H,4,7,10,12-13H2,1-3H3,(H,24,27)(H,28,29)/t16-,19?,20-/m1/s1 |
| InChIKey | JXRNUDHSAOWGNO-ZNCRQWOUSA-N |
| XLogP | 3.08 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |