C23H24F3N5O5 — CID 71285317
6-[4-[(3aR,4S,6aS)-4-azido-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 71285317) has the molecular formula C23H24F3N5O5 and a molecular weight of 507.47 g/mol. Its IUPAC name is 6-[4-[(3aR,4S,6aS)-4-azido-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[4-[(3aR,4S,6aS)-4-azido-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71285317 |
| Molecular Formula | C23H24F3N5O5 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 6-[4-[(3aR,4S,6aS)-4-azido-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCc1cc(C(=O)O)c(=O)[nH]c1-c1ccc(N2C[C@H]3CC[C@H](N=[N+]=[N-])[C@H]3C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23N5O3.C2HF3O2/c1-2-12-9-16(21(28)29)20(27)23-19(12)13-3-6-15(7-4-13)26-10-14-5-8-18(24-25-22)17(14)11-26;3-2(4,5)1(6)7/h3-4,6-7,9,14,17-18H,2,5,8,10-11H2,1H3,(H,23,27)(H,28,29);(H,6,7)/t14-,17+,18+;/m1./s1 |
| InChIKey | STDCKDVXUWYAJR-CVLULELNSA-N |
| XLogP | 4.46 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|