C23H30BN3O3 — CID 144545596
6-[4-[(5S,8aR)-5-(dimethylamino)-3,5,6,7,8,8a-hexahydro-1H-borinino[1,2-c][1,3]azaborol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 144545596) has the molecular formula C23H30BN3O3 and a molecular weight of 407.32 g/mol. Its IUPAC name is 6-[4-[(5S,8aR)-5-(dimethylamino)-3,5,6,7,8,8a-hexahydro-1H-borinino[1,2-c][1,3]azaborol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-[4-[(5S,8aR)-5-(dimethylamino)-3,5,6,7,8,8a-hexahydro-1H-borinino[1,2-c][1,3]azaborol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 144545596 |
| Molecular Formula | C23H30BN3O3 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 6-[4-[(5S,8aR)-5-(dimethylamino)-3,5,6,7,8,8a-hexahydro-1H-borinino[1,2-c][1,3]azaborol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(=O)[nH]c1-c1ccc(N2CB3[C@H](CCC[C@H]3N(C)C)C2)cc1 |
| InChI | InChI=1S/C23H30BN3O3/c1-4-15-12-19(23(29)30)22(28)25-21(15)16-8-10-18(11-9-16)27-13-17-6-5-7-20(26(2)3)24(17)14-27/h8-12,17,20H,4-7,13-14H2,1-3H3,(H,25,28)(H,29,30)/t17-,20-/m1/s1 |
| InChIKey | BBOAVWNZNTVGRX-YLJYHZDGSA-N |
| XLogP | 3.18 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|