C31H35N4O3+ — CID 123542625
[7-[benzyl(methyl)amino]-2-[4-(5-carboxy-3-ethyl-6-oxo-1H-pyridin-2-yl)phenyl]-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]-methylidyneazanium (PubChem CID 123542625) has the molecular formula C31H35N4O3+ and a molecular weight of 511.65 g/mol. Its IUPAC name is [7-[benzyl(methyl)amino]-2-[4-(5-carboxy-3-ethyl-6-oxo-1H-pyridin-2-yl)phenyl]-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]-methylidyneazanium.
| Compound Name | [7-[benzyl(methyl)amino]-2-[4-(5-carboxy-3-ethyl-6-oxo-1H-pyridin-2-yl)phenyl]-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]-methylidyneazanium |
|---|---|
| PubChem CID | 123542625 |
| Molecular Formula | C31H35N4O3+ |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | [7-[benzyl(methyl)amino]-2-[4-(5-carboxy-3-ethyl-6-oxo-1H-pyridin-2-yl)phenyl]-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]-methylidyneazanium |
| SMILES | C#[N+]C12CCCC(N(C)Cc3ccccc3)C1CN(c1ccc(-c3[nH]c(=O)c(C(=O)O)cc3CC)cc1)C2 |
| InChI | InChI=1S/C31H34N4O3/c1-4-22-17-25(30(37)38)29(36)33-28(22)23-12-14-24(15-13-23)35-19-26-27(11-8-16-31(26,20-35)32-2)34(3)18-21-9-6-5-7-10-21/h2,5-7,9-10,12-15,17,26-27H,4,8,11,16,18-20H2,1,3H3,(H-,33,36,37,38)/p+1 |
| InChIKey | VDWOFKUBWHZDJW-UHFFFAOYSA-O |
| XLogP | 5.12 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |