C24H24F3N3O5 — CID 71284881
15-[2-(ethylamino)ethyl]-14-methyl-4-oxo-6-(2,2,2-trifluoroacetyl)oxy-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaene-5-carboxylic acid (PubChem CID 71284881) has the molecular formula C24H24F3N3O5 and a molecular weight of 491.47 g/mol. Its IUPAC name is 15-[2-(ethylamino)ethyl]-14-methyl-4-oxo-6-(2,2,2-trifluoroacetyl)oxy-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaene-5-carboxylic acid.
| Compound Name | 15-[2-(ethylamino)ethyl]-14-methyl-4-oxo-6-(2,2,2-trifluoroacetyl)oxy-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 71284881 |
| Molecular Formula | C24H24F3N3O5 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 15-[2-(ethylamino)ethyl]-14-methyl-4-oxo-6-(2,2,2-trifluoroacetyl)oxy-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaene-5-carboxylic acid |
| SMILES | CCNCCc1cc2cc3c(cc2n1C)CCCc1c-3[nH]c(=O)c(C(=O)O)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H24F3N3O5/c1-3-28-8-7-14-9-13-10-16-12(11-17(13)30(14)2)5-4-6-15-19(16)29-21(31)18(22(32)33)20(15)35-23(34)24(25,26)27/h9-11,28H,3-8H2,1-2H3,(H,29,31)(H,32,33) |
| InChIKey | CHZHZFCNGBXHGR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|