C4H8Cl2N+ — CID 7128538
[(1S)-2,2-dichlorocyclopropyl]methylazanium (PubChem CID 7128538) has the molecular formula C4H8Cl2N+ and a molecular weight of 141.02 g/mol. Its IUPAC name is [(1S)-2,2-dichlorocyclopropyl]methylazanium.
| Compound Name | [(1S)-2,2-dichlorocyclopropyl]methylazanium |
|---|---|
| PubChem CID | 7128538 |
| Molecular Formula | C4H8Cl2N+ |
| Molecular Weight | 141.02 g/mol |
| Exact Mass | 140.00 |
| IUPAC Name | [(1S)-2,2-dichlorocyclopropyl]methylazanium |
| SMILES | [NH3+]C[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C4H7Cl2N/c5-4(6)1-3(4)2-7/h3H,1-2,7H2/p+1/t3-/m0/s1 |
| InChIKey | AZJBFYHLWRPAIH-VKHMYHEASA-O |
| XLogP | 0.42 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.02 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|