About CID 71286694
CID 71286694 (PubChem CID 71286694) has the molecular formula C13H10BO3
and a molecular weight of 225.03 g/mol.
Molecular Properties
| Compound Name | CID 71286694 |
| PubChem CID | 71286694 |
| Molecular Formula | C13H10BO3 |
| Molecular Weight | 225.03 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | — |
| SMILES | Oc1ccccc1Oc1ccc2c(c1)CO[B]2 |
| InChI | InChI=1S/C13H10BO3/c15-12-3-1-2-4-13(12)17-10-5-6-11-9(7-10)8-16-14-11/h1-7,15H,8H2 |
| InChIKey | UCBRKPDWPBBCKY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.03 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71286694 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71286694?
The IUPAC name of CID 71286694 (CID 71286694) is not available.
What is the SMILES notation for CID 71286694?
The canonical SMILES for CID 71286694 is Oc1ccccc1Oc1ccc2c(c1)CO[B]2.
What is the InChIKey of CID 71286694?
The InChIKey is UCBRKPDWPBBCKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BO3/c15-12-3-1-2-4-13(12)17-10-5-6-11-9(7-10)8-16-14-11/h1-7,15H,8H2.
What are the key properties of CID 71286694?
CID 71286694 has a molecular weight of 225.03 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71286694 is sourced from PubChem (CID 71286694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).