C9H15N7 — CID 71288130
N-methyl-1-(1-methyltriazol-4-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine (PubChem CID 71288130) has the molecular formula C9H15N7 and a molecular weight of 221.27 g/mol. Its IUPAC name is N-methyl-1-(1-methyltriazol-4-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine.
| Compound Name | N-methyl-1-(1-methyltriazol-4-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 71288130 |
| Molecular Formula | C9H15N7 |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-methyl-1-(1-methyltriazol-4-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine |
| SMILES | CN(Cc1cn(C)nn1)Cc1cn(C)nn1 |
| InChI | InChI=1S/C9H15N7/c1-14(4-8-6-15(2)12-10-8)5-9-7-16(3)13-11-9/h6-7H,4-5H2,1-3H3 |
| InChIKey | PVNHBFCSWUWPSZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |