C26H30N4O4S — CID 71290294
4-(1,3-oxazol-4-yl)-N-[4-(2-phenylpiperazine-1-carbonyl)cyclohexyl]benzenesulfonamide (PubChem CID 71290294) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 4-(1,3-oxazol-4-yl)-N-[4-(2-phenylpiperazine-1-carbonyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 4-(1,3-oxazol-4-yl)-N-[4-(2-phenylpiperazine-1-carbonyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71290294 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 4-(1,3-oxazol-4-yl)-N-[4-(2-phenylpiperazine-1-carbonyl)cyclohexyl]benzenesulfonamide |
| SMILES | O=C(C1CCC(NS(=O)(=O)c2ccc(-c3cocn3)cc2)CC1)N1CCNCC1c1ccccc1 |
| InChI | InChI=1S/C26H30N4O4S/c31-26(30-15-14-27-16-25(30)20-4-2-1-3-5-20)21-6-10-22(11-7-21)29-35(32,33)23-12-8-19(9-13-23)24-17-34-18-28-24/h1-5,8-9,12-13,17-18,21-22,25,27,29H,6-7,10-11,14-16H2 |
| InChIKey | IDWSNQSNHQTUQD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |