C32H37N3O5S — CID 77478338
ethyl 4-[4-[[4-(2-phenylpiperazine-1-carbonyl)cyclohexyl]sulfamoyl]phenyl]benzoate (PubChem CID 77478338) has the molecular formula C32H37N3O5S and a molecular weight of 575.73 g/mol. Its IUPAC name is ethyl 4-[4-[[4-(2-phenylpiperazine-1-carbonyl)cyclohexyl]sulfamoyl]phenyl]benzoate.
| Compound Name | ethyl 4-[4-[[4-(2-phenylpiperazine-1-carbonyl)cyclohexyl]sulfamoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 77478338 |
| Molecular Formula | C32H37N3O5S |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | ethyl 4-[4-[[4-(2-phenylpiperazine-1-carbonyl)cyclohexyl]sulfamoyl]phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(S(=O)(=O)NC3CCC(C(=O)N4CCNCC4c4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H37N3O5S/c1-2-40-32(37)27-10-8-23(9-11-27)24-14-18-29(19-15-24)41(38,39)34-28-16-12-26(13-17-28)31(36)35-21-20-33-22-30(35)25-6-4-3-5-7-25/h3-11,14-15,18-19,26,28,30,33-34H,2,12-13,16-17,20-22H2,1H3 |
| InChIKey | ZSAOVZBYIMGLGE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |