C40H69N3O8S — CID 71294376
tert-butyl 3-[(2S)-2,3-bis(decylcarbamoyloxy)propyl]sulfanyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 71294376) has the molecular formula C40H69N3O8S and a molecular weight of 752.07 g/mol. Its IUPAC name is tert-butyl 3-[(2S)-2,3-bis(decylcarbamoyloxy)propyl]sulfanyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl 3-[(2S)-2,3-bis(decylcarbamoyloxy)propyl]sulfanyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 71294376 |
| Molecular Formula | C40H69N3O8S |
| Molecular Weight | 752.07 g/mol |
| Exact Mass | 751.48 |
| IUPAC Name | tert-butyl 3-[(2S)-2,3-bis(decylcarbamoyloxy)propyl]sulfanyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCCCCCCCCCNC(=O)OC[C@@H](CSCC(NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C)OC(=O)NCCCCCCCCCC |
| InChI | InChI=1S/C40H69N3O8S/c1-6-8-10-12-14-16-18-23-27-41-37(45)49-30-34(50-38(46)42-28-24-19-17-15-13-11-9-7-2)31-52-32-35(36(44)51-40(3,4)5)43-39(47)48-29-33-25-21-20-22-26-33/h20-22,25-26,34-35H,6-19,23-24,27-32H2,1-5H3,(H,41,45)(H,42,46)(H,43,47)/t34-,35?/m0/s1 |
| InChIKey | PSJSKWFHJDWWJQ-SFCXHYMASA-N |
| XLogP | 9.46 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.07 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|