2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid

C17H16F2O4 — CID 71294679

IUPAC2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid
SMILESCC(OCC(=O)O)c1ccc(OCc2cc(F)ccc2F)cc1
InChIInChI=1S/C17H16F2O4/c1-11(22-10-17(20)21)12-2-5-15(6-3-12)23-9-13-8-14(18)4-7-16(13)19/h2-8,11H,9-10H2,1H3,(H,20,21)
InChIKeyWKFWACFHMSFHAD-UHFFFAOYSA-N
MW322.31 g/mol
LogP3.71
Rot. Bonds7

About 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid

2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid (PubChem CID 71294679) has the molecular formula C17H16F2O4 and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid.

Molecular Properties

Compound Name2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid
PubChem CID71294679
Molecular FormulaC17H16F2O4
Molecular Weight322.31 g/mol
Exact Mass322.10
IUPAC Name2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid
SMILESCC(OCC(=O)O)c1ccc(OCc2cc(F)ccc2F)cc1
InChIInChI=1S/C17H16F2O4/c1-11(22-10-17(20)21)12-2-5-15(6-3-12)23-9-13-8-14(18)4-7-16(13)19/h2-8,11H,9-10H2,1H3,(H,20,21)
InChIKeyWKFWACFHMSFHAD-UHFFFAOYSA-N
XLogP3.71
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.31
LogP ≤ 53.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid?
The IUPAC name of 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid (CID 71294679) is 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid.
What is the SMILES notation for 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid?
The canonical SMILES for 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid is CC(OCC(=O)O)c1ccc(OCc2cc(F)ccc2F)cc1.
What is the InChIKey of 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid?
The InChIKey is WKFWACFHMSFHAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2O4/c1-11(22-10-17(20)21)12-2-5-15(6-3-12)23-9-13-8-14(18)4-7-16(13)19/h2-8,11H,9-10H2,1H3,(H,20,21).
What are the key properties of 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid?
2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid has a molecular weight of 322.31 g/mol, XLogP of 3.71, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethoxy]acetic acid is sourced from PubChem (CID 71294679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).