C16H12ClN5 — CID 71295288
3-(2-chloro-6-methylphenyl)-7-methyl-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 71295288) has the molecular formula C16H12ClN5 and a molecular weight of 309.76 g/mol. Its IUPAC name is 3-(2-chloro-6-methylphenyl)-7-methyl-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-(2-chloro-6-methylphenyl)-7-methyl-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 71295288 |
| Molecular Formula | C16H12ClN5 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-(2-chloro-6-methylphenyl)-7-methyl-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | Cc1cccc(Cl)c1-c1nnc2c(C)nc3ncccc3n12 |
| InChI | InChI=1S/C16H12ClN5/c1-9-5-3-6-11(17)13(9)16-21-20-15-10(2)19-14-12(22(15)16)7-4-8-18-14/h3-8H,1-2H3 |
| InChIKey | GBABEYRPJLOPCN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |