C33H31N3O2 — CID 71295856
(4-benzhydrylpiperazin-1-yl)-[5-(4-methoxyphenyl)-1H-indol-2-yl]methanone (PubChem CID 71295856) has the molecular formula C33H31N3O2 and a molecular weight of 501.63 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[5-(4-methoxyphenyl)-1H-indol-2-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[5-(4-methoxyphenyl)-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 71295856 |
| Molecular Formula | C33H31N3O2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[5-(4-methoxyphenyl)-1H-indol-2-yl]methanone |
| SMILES | COc1ccc(-c2ccc3[nH]c(C(=O)N4CCN(C(c5ccccc5)c5ccccc5)CC4)cc3c2)cc1 |
| InChI | InChI=1S/C33H31N3O2/c1-38-29-15-12-24(13-16-29)27-14-17-30-28(22-27)23-31(34-30)33(37)36-20-18-35(19-21-36)32(25-8-4-2-5-9-25)26-10-6-3-7-11-26/h2-17,22-23,32,34H,18-21H2,1H3 |
| InChIKey | HUNCRBLOGOGBMB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |