C19H16F3NO5 — CID 7129760
ethyl (2R)-2-[4-[(3aR,7aS)-1,3-dioxo-3a,7a-dihydroisoindol-2-yl]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 7129760) has the molecular formula C19H16F3NO5 and a molecular weight of 395.33 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[(3aR,7aS)-1,3-dioxo-3a,7a-dihydroisoindol-2-yl]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | ethyl (2R)-2-[4-[(3aR,7aS)-1,3-dioxo-3a,7a-dihydroisoindol-2-yl]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 7129760 |
| Molecular Formula | C19H16F3NO5 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | ethyl (2R)-2-[4-[(3aR,7aS)-1,3-dioxo-3a,7a-dihydroisoindol-2-yl]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@](O)(c1ccc(N2C(=O)[C@H]3C=CC=C[C@H]3C2=O)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H16F3NO5/c1-2-28-17(26)18(27,19(20,21)22)11-7-9-12(10-8-11)23-15(24)13-5-3-4-6-14(13)16(23)25/h3-10,13-14,27H,2H2,1H3/t13-,14+,18-/m1/s1 |
| InChIKey | UAXMDCCBCWAWFA-QWQRMKEZSA-N |
| XLogP | 2.23 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|