C20H23N5O3 — CID 71301448
2-[(1-ethyl-4-methylpiperazin-2-ylidene)amino]-5-nitro-N-phenylbenzamide (PubChem CID 71301448) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-[(1-ethyl-4-methylpiperazin-2-ylidene)amino]-5-nitro-N-phenylbenzamide.
| Compound Name | 2-[(1-ethyl-4-methylpiperazin-2-ylidene)amino]-5-nitro-N-phenylbenzamide |
|---|---|
| PubChem CID | 71301448 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[(1-ethyl-4-methylpiperazin-2-ylidene)amino]-5-nitro-N-phenylbenzamide |
| SMILES | CCN1CCN(C)C/C1=N/c1ccc([N+](=O)[O-])cc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H23N5O3/c1-3-24-12-11-23(2)14-19(24)22-18-10-9-16(25(27)28)13-17(18)20(26)21-15-7-5-4-6-8-15/h4-10,13H,3,11-12,14H2,1-2H3,(H,21,26)/b22-19- |
| InChIKey | NPEFAIPQXBJTAS-QOCHGBHMSA-N |
| XLogP | 3.14 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|