C14H11IN2O — CID 71302995
3-iodo-4-phenylmethoxy-1H-pyrrolo[2,3-b]pyridine (PubChem CID 71302995) has the molecular formula C14H11IN2O and a molecular weight of 350.16 g/mol. Its IUPAC name is 3-iodo-4-phenylmethoxy-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-iodo-4-phenylmethoxy-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 71302995 |
| Molecular Formula | C14H11IN2O |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 3-iodo-4-phenylmethoxy-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Ic1c[nH]c2nccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C14H11IN2O/c15-11-8-17-14-13(11)12(6-7-16-14)18-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17) |
| InChIKey | MDJCZFWKMPSCSL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|