C11H8N4 — CID 71303141
4-(6-aminopyrazin-2-yl)benzonitrile (PubChem CID 71303141) has the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. Its IUPAC name is 4-(6-aminopyrazin-2-yl)benzonitrile.
| Compound Name | 4-(6-aminopyrazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 71303141 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-(6-aminopyrazin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2cncc(N)n2)cc1 |
| InChI | InChI=1S/C11H8N4/c12-5-8-1-3-9(4-2-8)10-6-14-7-11(13)15-10/h1-4,6-7H,(H2,13,15) |
| InChIKey | FDARFHBCDVTBDW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |